C31H30N2O5S2 — CID 14887997
1-[(2R,5S)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-(2-sulfanylethylsulfanyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione (PubChem CID 14887997) has the molecular formula C31H30N2O5S2 and a molecular weight of 574.72 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-(2-sulfanylethylsulfanyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-(2-sulfanylethylsulfanyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14887997 |
| Molecular Formula | C31H30N2O5S2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 1-[(2R,5S)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-(2-sulfanylethylsulfanyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@@H]2C=C(SCCS)[C@H](n3ccc(=O)[nH]c3=O)O2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30N2O5S2/c1-36-25-14-12-24(13-15-25)31(22-8-4-2-5-9-22,23-10-6-3-7-11-23)37-21-26-20-27(40-19-18-39)29(38-26)33-17-16-28(34)32-30(33)35/h2-17,20,26,29,39H,18-19,21H2,1H3,(H,32,34,35)/t26-,29+/m0/s1 |
| InChIKey | YXRLYOILQZERAU-LITSAYRRSA-N |
| XLogP | 5.00 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|