C32H28N4O5 — CID 15060390
1-[(2R,5S)-4-imidazol-1-yl-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione (PubChem CID 15060390) has the molecular formula C32H28N4O5 and a molecular weight of 548.60 g/mol. Its IUPAC name is 1-[(2R,5S)-4-imidazol-1-yl-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-4-imidazol-1-yl-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15060390 |
| Molecular Formula | C32H28N4O5 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 1-[(2R,5S)-4-imidazol-1-yl-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)C=C2n2ccnc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N4O5/c1-39-26-14-12-25(13-15-26)32(23-8-4-2-5-9-23,24-10-6-3-7-11-24)40-21-28-27(35-19-17-33-22-35)20-30(41-28)36-18-16-29(37)34-31(36)38/h2-20,22,28,30H,21H2,1H3,(H,34,37,38)/t28-,30-/m1/s1 |
| InChIKey | BEFMZVCUAVBVJJ-PQHLKRTFSA-N |
| XLogP | 4.19 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|