C15H20BClN2O5S — CID 149030716
tert-butyl N-[2-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamoylsulfanyl]ethyl]carbamate (PubChem CID 149030716) has the molecular formula C15H20BClN2O5S and a molecular weight of 386.67 g/mol. Its IUPAC name is tert-butyl N-[2-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamoylsulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamoylsulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 149030716 |
| Molecular Formula | C15H20BClN2O5S |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | tert-butyl N-[2-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamoylsulfanyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSC(=O)Nc1ccc2c(c1Cl)B(O)OC2 |
| InChI | InChI=1S/C15H20BClN2O5S/c1-15(2,3)24-13(20)18-6-7-25-14(21)19-10-5-4-9-8-23-16(22)11(9)12(10)17/h4-5,22H,6-8H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | QFJPEACWKCXLQY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|