C7H7N3OS2 — CID 149126785
1-(methyldisulfanyl)-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 149126785) has the molecular formula C7H7N3OS2 and a molecular weight of 213.29 g/mol. Its IUPAC name is 1-(methyldisulfanyl)-3H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 1-(methyldisulfanyl)-3H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 149126785 |
| Molecular Formula | C7H7N3OS2 |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 1-(methyldisulfanyl)-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CSSn1c(=O)[nH]c2ncccc21 |
| InChI | InChI=1S/C7H7N3OS2/c1-12-13-10-5-3-2-4-8-6(5)9-7(10)11/h2-4H,1H3,(H,8,9,11) |
| InChIKey | RBAYYHNHEOJBAJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|