C11H13N3OSi — CID 154242312
1-(2-trimethylsilylethynyl)-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 154242312) has the molecular formula C11H13N3OSi and a molecular weight of 231.33 g/mol. Its IUPAC name is 1-(2-trimethylsilylethynyl)-3H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 1-(2-trimethylsilylethynyl)-3H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 154242312 |
| Molecular Formula | C11H13N3OSi |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-(2-trimethylsilylethynyl)-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | C[Si](C)(C)C#Cn1c(=O)[nH]c2ncccc21 |
| InChI | InChI=1S/C11H13N3OSi/c1-16(2,3)8-7-14-9-5-4-6-12-10(9)13-11(14)15/h4-6H,1-3H3,(H,12,13,15) |
| InChIKey | HYHHYMWCWSEUNJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|