C6H7F8NO3S — CID 14928167
N-ethyl-1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide (PubChem CID 14928167) has the molecular formula C6H7F8NO3S and a molecular weight of 325.18 g/mol. Its IUPAC name is N-ethyl-1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide.
| Compound Name | N-ethyl-1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 14928167 |
| Molecular Formula | C6H7F8NO3S |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | N-ethyl-1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide |
| SMILES | CCNS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)F |
| InChI | InChI=1S/C6H7F8NO3S/c1-2-15-19(16,17)6(13,14)5(11,12)18-4(9,10)3(7)8/h3,15H,2H2,1H3 |
| InChIKey | WSDZNBXNEVXXSN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|