C4H6F5NO2S — CID 44717412
N-ethyl-1,1,2,2,2-pentafluoroethanesulfonamide (PubChem CID 44717412) has the molecular formula C4H6F5NO2S and a molecular weight of 227.15 g/mol. Its IUPAC name is N-ethyl-1,1,2,2,2-pentafluoroethanesulfonamide.
| Compound Name | N-ethyl-1,1,2,2,2-pentafluoroethanesulfonamide |
|---|---|
| PubChem CID | 44717412 |
| Molecular Formula | C4H6F5NO2S |
| Molecular Weight | 227.15 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | N-ethyl-1,1,2,2,2-pentafluoroethanesulfonamide |
| SMILES | CCNS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H6F5NO2S/c1-2-10-13(11,12)4(8,9)3(5,6)7/h10H,2H2,1H3 |
| InChIKey | KXJBWHWYJPNGSY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.15 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|