C26H27N3O2S — CID 149309293
3-[4-(4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]sulfonyl-5-methylaniline (PubChem CID 149309293) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is 3-[4-(4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]sulfonyl-5-methylaniline.
| Compound Name | 3-[4-(4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]sulfonyl-5-methylaniline |
|---|---|
| PubChem CID | 149309293 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 3-[4-(4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]sulfonyl-5-methylaniline |
| SMILES | Cc1cc(N)cc(S(=O)(=O)N2CCC(=C3c4ccccc4CCc4cccnc43)CC2)c1 |
| InChI | InChI=1S/C26H27N3O2S/c1-18-15-22(27)17-23(16-18)32(30,31)29-13-10-20(11-14-29)25-24-7-3-2-5-19(24)8-9-21-6-4-12-28-26(21)25/h2-7,12,15-17H,8-11,13-14,27H2,1H3 |
| InChIKey | XYHGUKRNYXMEEF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|