C12H13N — CID 149334435
4-methyl-6,7,8,8a-tetrahydrocyclopenta[b]indole (PubChem CID 149334435) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-methyl-6,7,8,8a-tetrahydrocyclopenta[b]indole.
| Compound Name | 4-methyl-6,7,8,8a-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 149334435 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 4-methyl-6,7,8,8a-tetrahydrocyclopenta[b]indole |
| SMILES | CN1C2=CCCCC2C2=C1C=C=C2 |
| InChI | InChI=1S/C12H13N/c1-13-11-7-3-2-5-9(11)10-6-4-8-12(10)13/h6-9H,2-3,5H2,1H3 |
| InChIKey | YCYMUBDZMJEZRY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |