C30H33IO7 — CID 149344448
[phenyl-[2-(4-prop-1-en-2-ylbenzoyl)oxyethoxycarbonyloxy]-λ3-iodanyl] adamantane-1-carboxylate (PubChem CID 149344448) has the molecular formula C30H33IO7 and a molecular weight of 632.49 g/mol. Its IUPAC name is [phenyl-[2-(4-prop-1-en-2-ylbenzoyl)oxyethoxycarbonyloxy]-λ3-iodanyl] adamantane-1-carboxylate.
| Compound Name | [phenyl-[2-(4-prop-1-en-2-ylbenzoyl)oxyethoxycarbonyloxy]-λ3-iodanyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 149344448 |
| Molecular Formula | C30H33IO7 |
| Molecular Weight | 632.49 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | [phenyl-[2-(4-prop-1-en-2-ylbenzoyl)oxyethoxycarbonyloxy]-λ3-iodanyl] adamantane-1-carboxylate |
| SMILES | C=C(C)c1ccc(C(=O)OCCOC(=O)OI(OC(=O)C23CC4CC(CC(C4)C2)C3)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H33IO7/c1-20(2)24-8-10-25(11-9-24)27(32)35-12-13-36-29(34)38-31(26-6-4-3-5-7-26)37-28(33)30-17-21-14-22(18-30)16-23(15-21)19-30/h3-11,21-23H,1,12-19H2,2H3 |
| InChIKey | YEUJAZZOKKPGBX-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.49 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|