C44H47IO6 — CID 154601301
[[3-(4-ethenylphenoxy)adamantane-1-carbonyl]oxy-phenyl-λ3-iodanyl] 3-(4-ethenylphenoxy)adamantane-1-carboxylate (PubChem CID 154601301) has the molecular formula C44H47IO6 and a molecular weight of 798.76 g/mol. Its IUPAC name is [[3-(4-ethenylphenoxy)adamantane-1-carbonyl]oxy-phenyl-λ3-iodanyl] 3-(4-ethenylphenoxy)adamantane-1-carboxylate.
| Compound Name | [[3-(4-ethenylphenoxy)adamantane-1-carbonyl]oxy-phenyl-λ3-iodanyl] 3-(4-ethenylphenoxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 154601301 |
| Molecular Formula | C44H47IO6 |
| Molecular Weight | 798.76 g/mol |
| Exact Mass | 798.24 |
| IUPAC Name | [[3-(4-ethenylphenoxy)adamantane-1-carbonyl]oxy-phenyl-λ3-iodanyl] 3-(4-ethenylphenoxy)adamantane-1-carboxylate |
| SMILES | C=Cc1ccc(OC23CC4CC(C2)CC(C(=O)OI(OC(=O)C25CC6CC(CC(Oc7ccc(C=C)cc7)(C6)C2)C5)c2ccccc2)(C4)C3)cc1 |
| InChI | InChI=1S/C44H47IO6/c1-3-30-10-14-37(15-11-30)48-43-24-32-18-33(25-43)21-41(20-32,28-43)39(46)50-45(36-8-6-5-7-9-36)51-40(47)42-22-34-19-35(23-42)27-44(26-34,29-42)49-38-16-12-31(4-2)13-17-38/h3-17,32-35H,1-2,18-29H2 |
| InChIKey | MGZXOJIRDXVYLD-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.76 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|