C26H23N4+ — CID 149381737
5-(2,3-dimethyl-1-phenylimidazol-3-ium-4-yl)-6-methylindolo[2,3-b]indole (PubChem CID 149381737) has the molecular formula C26H23N4+ and a molecular weight of 391.50 g/mol. Its IUPAC name is 5-(2,3-dimethyl-1-phenylimidazol-3-ium-4-yl)-6-methylindolo[2,3-b]indole.
| Compound Name | 5-(2,3-dimethyl-1-phenylimidazol-3-ium-4-yl)-6-methylindolo[2,3-b]indole |
|---|---|
| PubChem CID | 149381737 |
| Molecular Formula | C26H23N4+ |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 5-(2,3-dimethyl-1-phenylimidazol-3-ium-4-yl)-6-methylindolo[2,3-b]indole |
| SMILES | Cc1n(-c2ccccc2)cc(-n2c3ccccc3c3c4ccccc4n(C)c32)[n+]1C |
| InChI | InChI=1S/C26H23N4/c1-18-27(2)24(17-29(18)19-11-5-4-6-12-19)30-23-16-10-8-14-21(23)25-20-13-7-9-15-22(20)28(3)26(25)30/h4-17H,1-3H3/q+1 |
| InChIKey | TVPHZHRKLRSAQB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|