C26H28N3+ — CID 158220147
5-[4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-6-methylindolo[2,3-b]indole (PubChem CID 158220147) has the molecular formula C26H28N3+ and a molecular weight of 384.54 g/mol. Its IUPAC name is 5-[4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-6-methylindolo[2,3-b]indole.
| Compound Name | 5-[4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-6-methylindolo[2,3-b]indole |
|---|---|
| PubChem CID | 158220147 |
| Molecular Formula | C26H28N3+ |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 5-[4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-6-methylindolo[2,3-b]indole |
| SMILES | [2H]C([2H])(c1cc[n+](C)c(-n2c3ccccc3c3c4ccccc4n(C)c32)c1)C(C)(C)C |
| InChI | InChI=1S/C26H28N3/c1-26(2,3)17-18-14-15-27(4)23(16-18)29-22-13-9-7-11-20(22)24-19-10-6-8-12-21(19)28(5)25(24)29/h6-16H,17H2,1-5H3/q+1/i17D2 |
| InChIKey | GYLVRNTUDSFSQT-FBCWWBABSA-N |
| XLogP | 5.69 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|