C23H23N4+ — CID 158916906
4-methyl-3-(3-methyl-1-phenylimidazol-3-ium-4-yl)-1,2-bis(trideuteriomethyl)pyrrolo[2,3-b]indole (PubChem CID 158916906) has the molecular formula C23H23N4+ and a molecular weight of 361.50 g/mol. Its IUPAC name is 4-methyl-3-(3-methyl-1-phenylimidazol-3-ium-4-yl)-1,2-bis(trideuteriomethyl)pyrrolo[2,3-b]indole.
| Compound Name | 4-methyl-3-(3-methyl-1-phenylimidazol-3-ium-4-yl)-1,2-bis(trideuteriomethyl)pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 158916906 |
| Molecular Formula | C23H23N4+ |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 4-methyl-3-(3-methyl-1-phenylimidazol-3-ium-4-yl)-1,2-bis(trideuteriomethyl)pyrrolo[2,3-b]indole |
| SMILES | [2H]C([2H])([2H])c1c(C([2H])([2H])[2H])n(-c2cn(-c3ccccc3)c[n+]2C)c2c1c1ccccc1n2C |
| InChI | InChI=1S/C23H23N4/c1-16-17(2)27(23-22(16)19-12-8-9-13-20(19)25(23)4)21-14-26(15-24(21)3)18-10-6-5-7-11-18/h5-15H,1-4H3/q+1/i1D3,2D3 |
| InChIKey | ZXQBTRFUYBRIBN-WFGJKAKNSA-N |
| XLogP | 4.35 |
| TPSA | 18.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|