C24H25N4+ — CID 148580754
3-(2,3-dimethyl-1-phenylimidazol-3-ium-4-yl)-4-methyl-1,2-bis(trideuteriomethyl)pyrrolo[2,3-b]indole (PubChem CID 148580754) has the molecular formula C24H25N4+ and a molecular weight of 375.53 g/mol. Its IUPAC name is 3-(2,3-dimethyl-1-phenylimidazol-3-ium-4-yl)-4-methyl-1,2-bis(trideuteriomethyl)pyrrolo[2,3-b]indole.
| Compound Name | 3-(2,3-dimethyl-1-phenylimidazol-3-ium-4-yl)-4-methyl-1,2-bis(trideuteriomethyl)pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 148580754 |
| Molecular Formula | C24H25N4+ |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 3-(2,3-dimethyl-1-phenylimidazol-3-ium-4-yl)-4-methyl-1,2-bis(trideuteriomethyl)pyrrolo[2,3-b]indole |
| SMILES | [2H]C([2H])([2H])c1c(C([2H])([2H])[2H])n(-c2cn(-c3ccccc3)c(C)[n+]2C)c2c1c1ccccc1n2C |
| InChI | InChI=1S/C24H25N4/c1-16-17(2)28(24-23(16)20-13-9-10-14-21(20)26(24)5)22-15-27(18(3)25(22)4)19-11-7-6-8-12-19/h6-15H,1-5H3/q+1/i1D3,2D3 |
| InChIKey | CBBUOIGMYHXBJR-WFGJKAKNSA-N |
| XLogP | 4.66 |
| TPSA | 18.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|