C22H17F3O5S — CID 149453042
methyl 2-hydroxy-4-[[3-[4-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]benzoate (PubChem CID 149453042) has the molecular formula C22H17F3O5S and a molecular weight of 450.43 g/mol. Its IUPAC name is methyl 2-hydroxy-4-[[3-[4-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]benzoate.
| Compound Name | methyl 2-hydroxy-4-[[3-[4-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]benzoate |
|---|---|
| PubChem CID | 149453042 |
| Molecular Formula | C22H17F3O5S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | methyl 2-hydroxy-4-[[3-[4-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)c2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1O |
| InChI | InChI=1S/C22H17F3O5S/c1-30-21(27)19-10-5-14(11-20(19)26)13-31(28,29)18-4-2-3-16(12-18)15-6-8-17(9-7-15)22(23,24)25/h2-12,26H,13H2,1H3 |
| InChIKey | YXZZVDDBCLYWIR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |