C7H10 — CID 149455219
(2R,5R)-2-methylbicyclo[3.1.0]hex-1(6)-ene (PubChem CID 149455219) has the molecular formula C7H10 and a molecular weight of 94.16 g/mol. Its IUPAC name is (2R,5R)-2-methylbicyclo[3.1.0]hex-1(6)-ene.
| Compound Name | (2R,5R)-2-methylbicyclo[3.1.0]hex-1(6)-ene |
|---|---|
| PubChem CID | 149455219 |
| Molecular Formula | C7H10 |
| Molecular Weight | 94.16 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | (2R,5R)-2-methylbicyclo[3.1.0]hex-1(6)-ene |
| SMILES | C[C@@H]1CC[C@@H]2C=C12 |
| InChI | InChI=1S/C7H10/c1-5-2-3-6-4-7(5)6/h4-6H,2-3H2,1H3/t5-,6-/m1/s1 |
| InChIKey | YYKOTHBHXYNAHE-PHDIDXHHSA-N |
| XLogP | 1.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|