C11H9BrO — CID 14958668
7-bromo-5,9-dihydrobenzo[7]annulen-6-one (PubChem CID 14958668) has the molecular formula C11H9BrO and a molecular weight of 237.10 g/mol. Its IUPAC name is 7-bromo-5,9-dihydrobenzo[7]annulen-6-one.
| Compound Name | 7-bromo-5,9-dihydrobenzo[7]annulen-6-one |
|---|---|
| PubChem CID | 14958668 |
| Molecular Formula | C11H9BrO |
| Molecular Weight | 237.10 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 7-bromo-5,9-dihydrobenzo[7]annulen-6-one |
| SMILES | O=C1Cc2ccccc2CC=C1Br |
| InChI | InChI=1S/C11H9BrO/c12-10-6-5-8-3-1-2-4-9(8)7-11(10)13/h1-4,6H,5,7H2 |
| InChIKey | USLHFWXZQKRQJA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.10 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|