C9H8Cl3F3N2S — CID 14965128
3,5,6-trichloro-N-propyl-4-(trifluoromethylsulfanyl)pyridin-2-amine (PubChem CID 14965128) has the molecular formula C9H8Cl3F3N2S and a molecular weight of 339.60 g/mol. Its IUPAC name is 3,5,6-trichloro-N-propyl-4-(trifluoromethylsulfanyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-propyl-4-(trifluoromethylsulfanyl)pyridin-2-amine |
|---|---|
| PubChem CID | 14965128 |
| Molecular Formula | C9H8Cl3F3N2S |
| Molecular Weight | 339.60 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 3,5,6-trichloro-N-propyl-4-(trifluoromethylsulfanyl)pyridin-2-amine |
| SMILES | CCCNc1nc(Cl)c(Cl)c(SC(F)(F)F)c1Cl |
| InChI | InChI=1S/C9H8Cl3F3N2S/c1-2-3-16-8-5(11)6(18-9(13,14)15)4(10)7(12)17-8/h2-3H2,1H3,(H,16,17) |
| InChIKey | XPTDZUPMEMVRCH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|