C12H18O8S — CID 14992195
ethyl (2R,3R,4S,5R,6R)-3,6-diacetyloxy-4,5-dihydroxythiane-2-carboxylate (PubChem CID 14992195) has the molecular formula C12H18O8S and a molecular weight of 322.34 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5R,6R)-3,6-diacetyloxy-4,5-dihydroxythiane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5R,6R)-3,6-diacetyloxy-4,5-dihydroxythiane-2-carboxylate |
|---|---|
| PubChem CID | 14992195 |
| Molecular Formula | C12H18O8S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | ethyl (2R,3R,4S,5R,6R)-3,6-diacetyloxy-4,5-dihydroxythiane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1S[C@@H](OC(C)=O)[C@H](O)[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H18O8S/c1-4-18-11(17)10-9(19-5(2)13)7(15)8(16)12(21-10)20-6(3)14/h7-10,12,15-16H,4H2,1-3H3/t7-,8+,9+,10+,12+/m0/s1 |
| InChIKey | BWLIFDMZOSYZNN-PORUNHMFSA-N |
| XLogP | -0.79 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|