C5H6N2O4 — CID 15001716
5-methoxy-1,3-diazinane-2,4,6-trione (PubChem CID 15001716) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is 5-methoxy-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-methoxy-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15001716 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 5-methoxy-1,3-diazinane-2,4,6-trione |
| SMILES | COC1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O4/c1-11-2-3(8)6-5(10)7-4(2)9/h2H,1H3,(H2,6,7,8,9,10) |
| InChIKey | XNRQLKANHYMDGS-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|