C5H6N2O5 — CID 119096804
5-hydroxy-5-methoxy-1,3-diazinane-2,4,6-trione (PubChem CID 119096804) has the molecular formula C5H6N2O5 and a molecular weight of 174.11 g/mol. Its IUPAC name is 5-hydroxy-5-methoxy-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-hydroxy-5-methoxy-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 119096804 |
| Molecular Formula | C5H6N2O5 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 5-hydroxy-5-methoxy-1,3-diazinane-2,4,6-trione |
| SMILES | COC1(O)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O5/c1-12-5(11)2(8)6-4(10)7-3(5)9/h11H,1H3,(H2,6,7,8,9,10) |
| InChIKey | GFEWPEPHNMAJGK-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|