C6H7Cl3N2O3 — CID 117060351
5,5-dichloro-6-(chloromethyl)-6-methoxy-1,3-diazinane-2,4-dione (PubChem CID 117060351) has the molecular formula C6H7Cl3N2O3 and a molecular weight of 261.49 g/mol. Its IUPAC name is 5,5-dichloro-6-(chloromethyl)-6-methoxy-1,3-diazinane-2,4-dione.
| Compound Name | 5,5-dichloro-6-(chloromethyl)-6-methoxy-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 117060351 |
| Molecular Formula | C6H7Cl3N2O3 |
| Molecular Weight | 261.49 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | 5,5-dichloro-6-(chloromethyl)-6-methoxy-1,3-diazinane-2,4-dione |
| SMILES | COC1(CCl)NC(=O)NC(=O)C1(Cl)Cl |
| InChI | InChI=1S/C6H7Cl3N2O3/c1-14-5(2-7)6(8,9)3(12)10-4(13)11-5/h2H2,1H3,(H2,10,11,12,13) |
| InChIKey | NZXYVWWWTSJADA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.49 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|