C6H7F5O3S — CID 150042525
ethenyl 3,3,4,4,4-pentafluorobutane-1-sulfonate (PubChem CID 150042525) has the molecular formula C6H7F5O3S and a molecular weight of 254.18 g/mol. Its IUPAC name is ethenyl 3,3,4,4,4-pentafluorobutane-1-sulfonate.
| Compound Name | ethenyl 3,3,4,4,4-pentafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 150042525 |
| Molecular Formula | C6H7F5O3S |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | ethenyl 3,3,4,4,4-pentafluorobutane-1-sulfonate |
| SMILES | C=COS(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F5O3S/c1-2-14-15(12,13)4-3-5(7,8)6(9,10)11/h2H,1,3-4H2 |
| InChIKey | DJOXYXLYROZUDB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|