(8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid

C9H10BClO3 — CID 150094987

IUPAC(8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid
SMILESOB(O)c1ccc2c(c1Cl)OCCC2
InChIInChI=1S/C9H10BClO3/c11-8-7(10(12)13)4-3-6-2-1-5-14-9(6)8/h3-4,12-13H,1-2,5H2
InChIKeyDUAGGJNEYQOISV-UHFFFAOYSA-N
MW212.44 g/mol
LogP0.34
Rot. Bonds1

About (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid

(8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid (PubChem CID 150094987) has the molecular formula C9H10BClO3 and a molecular weight of 212.44 g/mol. Its IUPAC name is (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid.

Molecular Properties

Compound Name(8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid
PubChem CID150094987
Molecular FormulaC9H10BClO3
Molecular Weight212.44 g/mol
Exact Mass212.04
IUPAC Name(8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid
SMILESOB(O)c1ccc2c(c1Cl)OCCC2
InChIInChI=1S/C9H10BClO3/c11-8-7(10(12)13)4-3-6-2-1-5-14-9(6)8/h3-4,12-13H,1-2,5H2
InChIKeyDUAGGJNEYQOISV-UHFFFAOYSA-N
XLogP0.34
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.44
LogP ≤ 50.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid?
The IUPAC name of (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid (CID 150094987) is (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid.
What is the SMILES notation for (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid?
The canonical SMILES for (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid is OB(O)c1ccc2c(c1Cl)OCCC2.
What is the InChIKey of (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid?
The InChIKey is DUAGGJNEYQOISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BClO3/c11-8-7(10(12)13)4-3-6-2-1-5-14-9(6)8/h3-4,12-13H,1-2,5H2.
What are the key properties of (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid?
(8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid has a molecular weight of 212.44 g/mol, XLogP of 0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid is sourced from PubChem (CID 150094987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).