C9H10BClO3 — CID 150094987
(8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid (PubChem CID 150094987) has the molecular formula C9H10BClO3 and a molecular weight of 212.44 g/mol. Its IUPAC name is (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid.
| Compound Name | (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid |
|---|---|
| PubChem CID | 150094987 |
| Molecular Formula | C9H10BClO3 |
| Molecular Weight | 212.44 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (8-chloro-3,4-dihydro-2H-chromen-7-yl)boronic acid |
| SMILES | OB(O)c1ccc2c(c1Cl)OCCC2 |
| InChI | InChI=1S/C9H10BClO3/c11-8-7(10(12)13)4-3-6-2-1-5-14-9(6)8/h3-4,12-13H,1-2,5H2 |
| InChIKey | DUAGGJNEYQOISV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|