C17H14N4OS — CID 150095839
6-(furan-2-ylmethyl)-5-phenylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 150095839) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is 6-(furan-2-ylmethyl)-5-phenylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 6-(furan-2-ylmethyl)-5-phenylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 150095839 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 6-(furan-2-ylmethyl)-5-phenylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c2c(-c3ccccc3)c(Cc3ccco3)sc2n1 |
| InChI | InChI=1S/C17H14N4OS/c18-15-14-13(10-5-2-1-3-6-10)12(9-11-7-4-8-22-11)23-16(14)21-17(19)20-15/h1-8H,9H2,(H4,18,19,20,21) |
| InChIKey | DUFBEILHZGZNET-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |