C11H14N2O2 — CID 150110633
4,5-diamino-1-phenylpentane-1,2-dione (PubChem CID 150110633) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4,5-diamino-1-phenylpentane-1,2-dione.
| Compound Name | 4,5-diamino-1-phenylpentane-1,2-dione |
|---|---|
| PubChem CID | 150110633 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4,5-diamino-1-phenylpentane-1,2-dione |
| SMILES | NCC(N)CC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O2/c12-7-9(13)6-10(14)11(15)8-4-2-1-3-5-8/h1-5,9H,6-7,12-13H2 |
| InChIKey | DXEGIUIVFYNFDG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|