C20H24Cl2O3 — CID 150144706
4-(3,4-dichlorophenyl)peroxy-2,3,5,6-tetraethylphenol (PubChem CID 150144706) has the molecular formula C20H24Cl2O3 and a molecular weight of 383.32 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)peroxy-2,3,5,6-tetraethylphenol.
| Compound Name | 4-(3,4-dichlorophenyl)peroxy-2,3,5,6-tetraethylphenol |
|---|---|
| PubChem CID | 150144706 |
| Molecular Formula | C20H24Cl2O3 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-(3,4-dichlorophenyl)peroxy-2,3,5,6-tetraethylphenol |
| SMILES | CCc1c(O)c(CC)c(CC)c(OOc2ccc(Cl)c(Cl)c2)c1CC |
| InChI | InChI=1S/C20H24Cl2O3/c1-5-13-15(7-3)20(16(8-4)14(6-2)19(13)23)25-24-12-9-10-17(21)18(22)11-12/h9-11,23H,5-8H2,1-4H3 |
| InChIKey | FDZWNUDTNRNCGB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|