C14H19Cl2NO4 — CID 150180407
methyl 2-[4,5-dichloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexa-1,3-dien-1-yl]acetate (PubChem CID 150180407) has the molecular formula C14H19Cl2NO4 and a molecular weight of 336.22 g/mol. Its IUPAC name is methyl 2-[4,5-dichloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexa-1,3-dien-1-yl]acetate.
| Compound Name | methyl 2-[4,5-dichloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexa-1,3-dien-1-yl]acetate |
|---|---|
| PubChem CID | 150180407 |
| Molecular Formula | C14H19Cl2NO4 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | methyl 2-[4,5-dichloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexa-1,3-dien-1-yl]acetate |
| SMILES | COC(=O)CC1=CC=C(Cl)C(Cl)(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H19Cl2NO4/c1-13(2,3)21-12(19)17-14(16)8-9(5-6-10(14)15)7-11(18)20-4/h5-6H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | FLHMXQHPAWFSDF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|