C16H24N4O4 — CID 15023889
7-(5,6-dihydroxyhexyl)-3-ethyl-1-prop-2-enylpurine-2,6-dione (PubChem CID 15023889) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 7-(5,6-dihydroxyhexyl)-3-ethyl-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 7-(5,6-dihydroxyhexyl)-3-ethyl-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 15023889 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 7-(5,6-dihydroxyhexyl)-3-ethyl-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2CCCCC(O)CO)n(CC)c1=O |
| InChI | InChI=1S/C16H24N4O4/c1-3-8-20-15(23)13-14(19(4-2)16(20)24)17-11-18(13)9-6-5-7-12(22)10-21/h3,11-12,21-22H,1,4-10H2,2H3 |
| InChIKey | NHNVPYGDDRRIBI-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|