C20H12F3N3O3 — CID 150241776
N-hydroxy-4-[2-(trifluoromethyl)pyrido[2,3-b][1,4]benzoxazepin-3-yl]benzamide (PubChem CID 150241776) has the molecular formula C20H12F3N3O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is N-hydroxy-4-[2-(trifluoromethyl)pyrido[2,3-b][1,4]benzoxazepin-3-yl]benzamide.
| Compound Name | N-hydroxy-4-[2-(trifluoromethyl)pyrido[2,3-b][1,4]benzoxazepin-3-yl]benzamide |
|---|---|
| PubChem CID | 150241776 |
| Molecular Formula | C20H12F3N3O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-hydroxy-4-[2-(trifluoromethyl)pyrido[2,3-b][1,4]benzoxazepin-3-yl]benzamide |
| SMILES | O=C(NO)c1ccc(-c2cc3c(nc2C(F)(F)F)Oc2ccccc2C=N3)cc1 |
| InChI | InChI=1S/C20H12F3N3O3/c21-20(22,23)17-14(11-5-7-12(8-6-11)18(27)26-28)9-15-19(25-17)29-16-4-2-1-3-13(16)10-24-15/h1-10,28H,(H,26,27) |
| InChIKey | FXRHYMGAGWERRW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|