About dilithium;phenylsulfonylbenzene
dilithium;phenylsulfonylbenzene (PubChem CID 15026453) has the molecular formula C12H8Li2O2S
and a molecular weight of 230.14 g/mol. Its IUPAC name is dilithium;phenylsulfonylbenzene.
Molecular Properties
| Compound Name | dilithium;phenylsulfonylbenzene |
| PubChem CID | 15026453 |
| Molecular Formula | C12H8Li2O2S |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | dilithium;phenylsulfonylbenzene |
| SMILES | O=S(=O)(c1[c-]cccc1)c1[c-]cccc1.[Li+].[Li+] |
| InChI | InChI=1S/C12H8O2S.2Li/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-7,9H;;/q-2;2*+1 |
| InChIKey | BQQMWCKCWVIVBD-UHFFFAOYSA-N |
| XLogP | -3.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dilithium;phenylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;phenylsulfonylbenzene?
The IUPAC name of dilithium;phenylsulfonylbenzene (CID 15026453) is dilithium;phenylsulfonylbenzene.
What is the SMILES notation for dilithium;phenylsulfonylbenzene?
The canonical SMILES for dilithium;phenylsulfonylbenzene is O=S(=O)(c1[c-]cccc1)c1[c-]cccc1.[Li+].[Li+].
What is the InChIKey of dilithium;phenylsulfonylbenzene?
The InChIKey is BQQMWCKCWVIVBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2S.2Li/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-7,9H;;/q-2;2*+1.
What are the key properties of dilithium;phenylsulfonylbenzene?
dilithium;phenylsulfonylbenzene has a molecular weight of 230.14 g/mol, XLogP of -3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;phenylsulfonylbenzene is sourced from PubChem (CID 15026453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).