2-propoxy-3,4-dihydrochromene-2-carboxylic acid

C13H16O4 — CID 150273044

IUPAC2-propoxy-3,4-dihydrochromene-2-carboxylic acid
SMILESCCCOC1(C(=O)O)CCc2ccccc2O1
InChIInChI=1S/C13H16O4/c1-2-9-16-13(12(14)15)8-7-10-5-3-4-6-11(10)17-13/h3-6H,2,7-9H2,1H3,(H,14,15)
InChIKeyGDYZBUGLSWFVBI-UHFFFAOYSA-N
MW236.27 g/mol
LogP2.22
Rot. Bonds4

About 2-propoxy-3,4-dihydrochromene-2-carboxylic acid

2-propoxy-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 150273044) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-propoxy-3,4-dihydrochromene-2-carboxylic acid.

Molecular Properties

Compound Name2-propoxy-3,4-dihydrochromene-2-carboxylic acid
PubChem CID150273044
Molecular FormulaC13H16O4
Molecular Weight236.27 g/mol
Exact Mass236.10
IUPAC Name2-propoxy-3,4-dihydrochromene-2-carboxylic acid
SMILESCCCOC1(C(=O)O)CCc2ccccc2O1
InChIInChI=1S/C13H16O4/c1-2-9-16-13(12(14)15)8-7-10-5-3-4-6-11(10)17-13/h3-6H,2,7-9H2,1H3,(H,14,15)
InChIKeyGDYZBUGLSWFVBI-UHFFFAOYSA-N
XLogP2.22
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 52.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-propoxy-3,4-dihydrochromene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propoxy-3,4-dihydrochromene-2-carboxylic acid?
The IUPAC name of 2-propoxy-3,4-dihydrochromene-2-carboxylic acid (CID 150273044) is 2-propoxy-3,4-dihydrochromene-2-carboxylic acid.
What is the SMILES notation for 2-propoxy-3,4-dihydrochromene-2-carboxylic acid?
The canonical SMILES for 2-propoxy-3,4-dihydrochromene-2-carboxylic acid is CCCOC1(C(=O)O)CCc2ccccc2O1.
What is the InChIKey of 2-propoxy-3,4-dihydrochromene-2-carboxylic acid?
The InChIKey is GDYZBUGLSWFVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-2-9-16-13(12(14)15)8-7-10-5-3-4-6-11(10)17-13/h3-6H,2,7-9H2,1H3,(H,14,15).
What are the key properties of 2-propoxy-3,4-dihydrochromene-2-carboxylic acid?
2-propoxy-3,4-dihydrochromene-2-carboxylic acid has a molecular weight of 236.27 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-3,4-dihydrochromene-2-carboxylic acid is sourced from PubChem (CID 150273044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).