C22H32N2O5 — CID 150302298
N-[7-[3-(dipropylamino)propyl]-8-(methoxymethoxy)-2-oxochromen-3-yl]acetamide (PubChem CID 150302298) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[7-[3-(dipropylamino)propyl]-8-(methoxymethoxy)-2-oxochromen-3-yl]acetamide.
| Compound Name | N-[7-[3-(dipropylamino)propyl]-8-(methoxymethoxy)-2-oxochromen-3-yl]acetamide |
|---|---|
| PubChem CID | 150302298 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-[7-[3-(dipropylamino)propyl]-8-(methoxymethoxy)-2-oxochromen-3-yl]acetamide |
| SMILES | CCCN(CCC)CCCc1ccc2cc(NC(C)=O)c(=O)oc2c1OCOC |
| InChI | InChI=1S/C22H32N2O5/c1-5-11-24(12-6-2)13-7-8-17-9-10-18-14-19(23-16(3)25)22(26)29-21(18)20(17)28-15-27-4/h9-10,14H,5-8,11-13,15H2,1-4H3,(H,23,25) |
| InChIKey | GJWDPKYIUPOBGK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|