C19H19NO6 — CID 18505489
N-[2-[4-(methoxymethoxy)-3,5-dimethyl-6-oxopyran-2-yl]-1-benzofuran-5-yl]acetamide (PubChem CID 18505489) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is N-[2-[4-(methoxymethoxy)-3,5-dimethyl-6-oxopyran-2-yl]-1-benzofuran-5-yl]acetamide.
| Compound Name | N-[2-[4-(methoxymethoxy)-3,5-dimethyl-6-oxopyran-2-yl]-1-benzofuran-5-yl]acetamide |
|---|---|
| PubChem CID | 18505489 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[2-[4-(methoxymethoxy)-3,5-dimethyl-6-oxopyran-2-yl]-1-benzofuran-5-yl]acetamide |
| SMILES | COCOc1c(C)c(-c2cc3cc(NC(C)=O)ccc3o2)oc(=O)c1C |
| InChI | InChI=1S/C19H19NO6/c1-10-17(24-9-23-4)11(2)19(22)26-18(10)16-8-13-7-14(20-12(3)21)5-6-15(13)25-16/h5-8H,9H2,1-4H3,(H,20,21) |
| InChIKey | MWUBJPJVIOEZME-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|