C44H84O5Si — CID 150306604
tri(propan-2-yl)-[[(2R,3R,4R,5R)-3,4,5-tris(dec-9-enoxy)oxolan-2-yl]methoxy]silane (PubChem CID 150306604) has the molecular formula C44H84O5Si and a molecular weight of 721.24 g/mol. Its IUPAC name is tri(propan-2-yl)-[[(2R,3R,4R,5R)-3,4,5-tris(dec-9-enoxy)oxolan-2-yl]methoxy]silane.
| Compound Name | tri(propan-2-yl)-[[(2R,3R,4R,5R)-3,4,5-tris(dec-9-enoxy)oxolan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 150306604 |
| Molecular Formula | C44H84O5Si |
| Molecular Weight | 721.24 g/mol |
| Exact Mass | 720.61 |
| IUPAC Name | tri(propan-2-yl)-[[(2R,3R,4R,5R)-3,4,5-tris(dec-9-enoxy)oxolan-2-yl]methoxy]silane |
| SMILES | C=CCCCCCCCCO[C@@H]1O[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](OCCCCCCCCC=C)[C@H]1OCCCCCCCCC=C |
| InChI | InChI=1S/C44H84O5Si/c1-10-13-16-19-22-25-28-31-34-45-42-41(37-48-50(38(4)5,39(6)7)40(8)9)49-44(47-36-33-30-27-24-21-18-15-12-3)43(42)46-35-32-29-26-23-20-17-14-11-2/h10-12,38-44H,1-3,13-37H2,4-9H3/t41-,42-,43-,44-/m1/s1 |
| InChIKey | GKSNRYVKBRBMPL-OWIHLRRYSA-N |
| XLogP | 13.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.24 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|