C28H26O9 — CID 150382081
3-[2-[2,2-bis(2,3-dihydroxyphenyl)ethoxy]-1-(2,3-dihydroxyphenyl)ethyl]benzene-1,2-diol (PubChem CID 150382081) has the molecular formula C28H26O9 and a molecular weight of 506.51 g/mol. Its IUPAC name is 3-[2-[2,2-bis(2,3-dihydroxyphenyl)ethoxy]-1-(2,3-dihydroxyphenyl)ethyl]benzene-1,2-diol.
| Compound Name | 3-[2-[2,2-bis(2,3-dihydroxyphenyl)ethoxy]-1-(2,3-dihydroxyphenyl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 150382081 |
| Molecular Formula | C28H26O9 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 3-[2-[2,2-bis(2,3-dihydroxyphenyl)ethoxy]-1-(2,3-dihydroxyphenyl)ethyl]benzene-1,2-diol |
| SMILES | Oc1cccc(C(COCC(c2cccc(O)c2O)c2cccc(O)c2O)c2cccc(O)c2O)c1O |
| InChI | InChI=1S/C28H26O9/c29-21-9-1-5-15(25(21)33)19(16-6-2-10-22(30)26(16)34)13-37-14-20(17-7-3-11-23(31)27(17)35)18-8-4-12-24(32)28(18)36/h1-12,19-20,29-36H,13-14H2 |
| InChIKey | GZYMGBCTPKRBET-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|