C7H12O5S — CID 150398728
1-[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxythian-2-yl]ethanone (PubChem CID 150398728) has the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxythian-2-yl]ethanone.
| Compound Name | 1-[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxythian-2-yl]ethanone |
|---|---|
| PubChem CID | 150398728 |
| Molecular Formula | C7H12O5S |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxythian-2-yl]ethanone |
| SMILES | CC(=O)[C@]1(O)SC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H12O5S/c1-3(8)7(12)6(11)5(10)4(9)2-13-7/h4-6,9-12H,2H2,1H3/t4-,5+,6-,7+/m1/s1 |
| InChIKey | HDHLQFGMTCGANY-UCROKIRRSA-N |
| XLogP | -1.91 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |