C28H41NO4 — CID 150416478
(2S)-2-[(1R)-1-cyclohexyl-3-phenylpropyl]-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid (PubChem CID 150416478) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is (2S)-2-[(1R)-1-cyclohexyl-3-phenylpropyl]-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid.
| Compound Name | (2S)-2-[(1R)-1-cyclohexyl-3-phenylpropyl]-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 150416478 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | (2S)-2-[(1R)-1-cyclohexyl-3-phenylpropyl]-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC[C@@]1(C(=O)O)[C@H](CCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C28H41NO4/c1-4-27(2,3)24(30)25(31)29-20-12-11-19-28(29,26(32)33)23(22-15-9-6-10-16-22)18-17-21-13-7-5-8-14-21/h5,7-8,13-14,22-23H,4,6,9-12,15-20H2,1-3H3,(H,32,33)/t23-,28+/m1/s1 |
| InChIKey | HGWUOCCPBOJPCZ-LXFBAYGMSA-N |
| XLogP | 5.66 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|