C8H15N2+ — CID 150422346
1,1-diethyl-2-methylimidazol-1-ium (PubChem CID 150422346) has the molecular formula C8H15N2+ and a molecular weight of 139.22 g/mol. Its IUPAC name is 1,1-diethyl-2-methylimidazol-1-ium.
| Compound Name | 1,1-diethyl-2-methylimidazol-1-ium |
|---|---|
| PubChem CID | 150422346 |
| Molecular Formula | C8H15N2+ |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | 1,1-diethyl-2-methylimidazol-1-ium |
| SMILES | CC[N+]1(CC)C=CN=C1C |
| InChI | InChI=1S/C8H15N2/c1-4-10(5-2)7-6-9-8(10)3/h6-7H,4-5H2,1-3H3/q+1 |
| InChIKey | HIBBILIJZOCOIQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|