C17H20N8O2 — CID 150431743
9-(2-methoxyphenyl)-8-oxo-2-[[(3R)-pyrrolidin-3-yl]amino]-7H-purine-6-carboximidamide (PubChem CID 150431743) has the molecular formula C17H20N8O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 9-(2-methoxyphenyl)-8-oxo-2-[[(3R)-pyrrolidin-3-yl]amino]-7H-purine-6-carboximidamide.
| Compound Name | 9-(2-methoxyphenyl)-8-oxo-2-[[(3R)-pyrrolidin-3-yl]amino]-7H-purine-6-carboximidamide |
|---|---|
| PubChem CID | 150431743 |
| Molecular Formula | C17H20N8O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 9-(2-methoxyphenyl)-8-oxo-2-[[(3R)-pyrrolidin-3-yl]amino]-7H-purine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc(N[C@@H]2CCNC2)nc2c1[nH]c(=O)n2-c1ccccc1OC |
| InChI | InChI=1S/C17H20N8O2/c1-27-11-5-3-2-4-10(11)25-15-13(23-17(25)26)12(14(18)19)22-16(24-15)21-9-6-7-20-8-9/h2-5,9,20H,6-8H2,1H3,(H3,18,19)(H,23,26)(H,21,22,24)/t9-/m1/s1 |
| InChIKey | HJXQWHKDBHQRIZ-SECBINFHSA-N |
| XLogP | 0.18 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|