C18H21N7O3 — CID 57480370
9-(2-methoxyphenyl)-8-oxo-2-(pyrrolidin-2-ylmethylamino)-7H-purine-6-carboxamide (PubChem CID 57480370) has the molecular formula C18H21N7O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 9-(2-methoxyphenyl)-8-oxo-2-(pyrrolidin-2-ylmethylamino)-7H-purine-6-carboxamide.
| Compound Name | 9-(2-methoxyphenyl)-8-oxo-2-(pyrrolidin-2-ylmethylamino)-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 57480370 |
| Molecular Formula | C18H21N7O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 9-(2-methoxyphenyl)-8-oxo-2-(pyrrolidin-2-ylmethylamino)-7H-purine-6-carboxamide |
| SMILES | COc1ccccc1-n1c(=O)[nH]c2c(C(N)=O)nc(NCC3CCCN3)nc21 |
| InChI | InChI=1S/C18H21N7O3/c1-28-12-7-3-2-6-11(12)25-16-14(23-18(25)27)13(15(19)26)22-17(24-16)21-9-10-5-4-8-20-10/h2-3,6-7,10,20H,4-5,8-9H2,1H3,(H2,19,26)(H,23,27)(H,21,22,24) |
| InChIKey | XIDQEHKOCLLHLJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |