C37H48O6S2 — CID 150447171
5-methyl-2-propan-2-yl-4-[2,4,6-tris(1-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonic acid (PubChem CID 150447171) has the molecular formula C37H48O6S2 and a molecular weight of 652.92 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-4-[2,4,6-tris(1-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonic acid.
| Compound Name | 5-methyl-2-propan-2-yl-4-[2,4,6-tris(1-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 150447171 |
| Molecular Formula | C37H48O6S2 |
| Molecular Weight | 652.92 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | 5-methyl-2-propan-2-yl-4-[2,4,6-tris(1-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(C(C)C)cc1OS(=O)(=O)c1c(C23CCC(CC2)C3)cc(C23CCC(CC2)C3)cc1C12CCC(CC1)C2 |
| InChI | InChI=1S/C37H48O6S2/c1-23(2)29-19-32(24(3)16-33(29)44(38,39)40)43-45(41,42)34-30(36-12-6-26(21-36)7-13-36)17-28(35-10-4-25(20-35)5-11-35)18-31(34)37-14-8-27(22-37)9-15-37/h16-19,23,25-27H,4-15,20-22H2,1-3H3,(H,38,39,40) |
| InChIKey | HMZXLANSOBPVGL-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.92 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|