C17H11F9N2O2 — CID 150474316
1-[(2,6-difluorophenyl)methyl]-3-[2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]urea (PubChem CID 150474316) has the molecular formula C17H11F9N2O2 and a molecular weight of 446.27 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-3-[2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]urea.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-3-[2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]urea |
|---|---|
| PubChem CID | 150474316 |
| Molecular Formula | C17H11F9N2O2 |
| Molecular Weight | 446.27 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-3-[2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]urea |
| SMILES | O=C(NCc1c(F)cccc1F)Nc1ccc(OC(F)(F)C(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C17H11F9N2O2/c18-10-2-1-3-11(19)9(10)7-27-15(29)28-13-5-4-8(6-12(13)20)30-17(25,26)14(21)16(22,23)24/h1-6,14H,7H2,(H2,27,28,29) |
| InChIKey | HSLVWPOHNOIECG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.27 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |