C68H92P2 — CID 150490134
[4-[4-bis(2,4-ditert-butylphenyl)phosphanylphenyl]phenyl]-bis(2,4-ditert-butylphenyl)phosphane (PubChem CID 150490134) has the molecular formula C68H92P2 and a molecular weight of 971.43 g/mol. Its IUPAC name is [4-[4-bis(2,4-ditert-butylphenyl)phosphanylphenyl]phenyl]-bis(2,4-ditert-butylphenyl)phosphane.
| Compound Name | [4-[4-bis(2,4-ditert-butylphenyl)phosphanylphenyl]phenyl]-bis(2,4-ditert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 150490134 |
| Molecular Formula | C68H92P2 |
| Molecular Weight | 971.43 g/mol |
| Exact Mass | 970.67 |
| IUPAC Name | [4-[4-bis(2,4-ditert-butylphenyl)phosphanylphenyl]phenyl]-bis(2,4-ditert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1ccc(P(c2ccc(-c3ccc(P(c4ccc(C(C)(C)C)cc4C(C)(C)C)c4ccc(C(C)(C)C)cc4C(C)(C)C)cc3)cc2)c2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H92P2/c1-61(2,3)47-29-37-57(53(41-47)65(13,14)15)69(58-38-30-48(62(4,5)6)42-54(58)66(16,17)18)51-33-25-45(26-34-51)46-27-35-52(36-28-46)70(59-39-31-49(63(7,8)9)43-55(59)67(19,20)21)60-40-32-50(64(10,11)12)44-56(60)68(22,23)24/h25-44H,1-24H3 |
| InChIKey | HVPWXYYHNKRBOJ-UHFFFAOYSA-N |
| XLogP | 17.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.43 |
| LogP ≤ 5 | 17.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|