C14H15NO4 — CID 150509741
2-(ethyliminomethyl)-3-hydroxy-5-(4-hydroxyphenyl)penta-2,4-dienoic acid (PubChem CID 150509741) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(ethyliminomethyl)-3-hydroxy-5-(4-hydroxyphenyl)penta-2,4-dienoic acid.
| Compound Name | 2-(ethyliminomethyl)-3-hydroxy-5-(4-hydroxyphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 150509741 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-(ethyliminomethyl)-3-hydroxy-5-(4-hydroxyphenyl)penta-2,4-dienoic acid |
| SMILES | CC/N=C/C(C(=O)O)=C(O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H15NO4/c1-2-15-9-12(14(18)19)13(17)8-5-10-3-6-11(16)7-4-10/h3-9,16-17H,2H2,1H3,(H,18,19)/b8-5?,13-12?,15-9+ |
| InChIKey | SAXZULPBHAXAAH-ILAHNWETSA-N |
| XLogP | 2.39 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|