About Se-(cyanomethyl) 4-methylbenzenecarboselenoate
Se-(cyanomethyl) 4-methylbenzenecarboselenoate (PubChem CID 150515491) has the molecular formula C10H9NOSe
and a molecular weight of 238.15 g/mol. Its IUPAC name is Se-(cyanomethyl) 4-methylbenzenecarboselenoate.
Molecular Properties
| Compound Name | Se-(cyanomethyl) 4-methylbenzenecarboselenoate |
| PubChem CID | 150515491 |
| Molecular Formula | C10H9NOSe |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | Se-(cyanomethyl) 4-methylbenzenecarboselenoate |
| SMILES | Cc1ccc(C(=O)[Se]CC#N)cc1 |
| InChI | InChI=1S/C10H9NOSe/c1-8-2-4-9(5-3-8)10(12)13-7-6-11/h2-5H,7H2,1H3 |
| InChIKey | IASPOMUNCPZFCI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Se-(cyanomethyl) 4-methylbenzenecarboselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-(cyanomethyl) 4-methylbenzenecarboselenoate?
The IUPAC name of Se-(cyanomethyl) 4-methylbenzenecarboselenoate (CID 150515491) is Se-(cyanomethyl) 4-methylbenzenecarboselenoate.
What is the SMILES notation for Se-(cyanomethyl) 4-methylbenzenecarboselenoate?
The canonical SMILES for Se-(cyanomethyl) 4-methylbenzenecarboselenoate is Cc1ccc(C(=O)[Se]CC#N)cc1.
What is the InChIKey of Se-(cyanomethyl) 4-methylbenzenecarboselenoate?
The InChIKey is IASPOMUNCPZFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOSe/c1-8-2-4-9(5-3-8)10(12)13-7-6-11/h2-5H,7H2,1H3.
What are the key properties of Se-(cyanomethyl) 4-methylbenzenecarboselenoate?
Se-(cyanomethyl) 4-methylbenzenecarboselenoate has a molecular weight of 238.15 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Se-(cyanomethyl) 4-methylbenzenecarboselenoate is sourced from PubChem (CID 150515491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).