C7H11NO3 — CID 150517849
[4,5-bis(hydroxymethyl)-1H-pyrrol-3-yl]methanol (PubChem CID 150517849) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is [4,5-bis(hydroxymethyl)-1H-pyrrol-3-yl]methanol.
| Compound Name | [4,5-bis(hydroxymethyl)-1H-pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 150517849 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | [4,5-bis(hydroxymethyl)-1H-pyrrol-3-yl]methanol |
| SMILES | OCc1c[nH]c(CO)c1CO |
| InChI | InChI=1S/C7H11NO3/c9-2-5-1-8-7(4-11)6(5)3-10/h1,8-11H,2-4H2 |
| InChIKey | IBEOSCAFFSWXCG-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |