C19H22F2N4OS — CID 150530415
1-[5-(2,4-difluorophenyl)sulfanyl-1-methoxypentan-2-yl]-7-methylimidazo[4,5-c]pyridin-4-amine (PubChem CID 150530415) has the molecular formula C19H22F2N4OS and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-[5-(2,4-difluorophenyl)sulfanyl-1-methoxypentan-2-yl]-7-methylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[5-(2,4-difluorophenyl)sulfanyl-1-methoxypentan-2-yl]-7-methylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 150530415 |
| Molecular Formula | C19H22F2N4OS |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[5-(2,4-difluorophenyl)sulfanyl-1-methoxypentan-2-yl]-7-methylimidazo[4,5-c]pyridin-4-amine |
| SMILES | COCC(CCCSc1ccc(F)cc1F)n1cnc2c(N)ncc(C)c21 |
| InChI | InChI=1S/C19H22F2N4OS/c1-12-9-23-19(22)17-18(12)25(11-24-17)14(10-26-2)4-3-7-27-16-6-5-13(20)8-15(16)21/h5-6,8-9,11,14H,3-4,7,10H2,1-2H3,(H2,22,23) |
| InChIKey | IDSHMJBLRIWCBC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|