C17H18F2N4S — CID 22666210
1-[3-(2,4-difluorophenyl)sulfanylpropyl]-2,7-dimethylimidazo[4,5-c]pyridin-4-amine (PubChem CID 22666210) has the molecular formula C17H18F2N4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-[3-(2,4-difluorophenyl)sulfanylpropyl]-2,7-dimethylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[3-(2,4-difluorophenyl)sulfanylpropyl]-2,7-dimethylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 22666210 |
| Molecular Formula | C17H18F2N4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-[3-(2,4-difluorophenyl)sulfanylpropyl]-2,7-dimethylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cnc(N)c2nc(C)n(CCCSc3ccc(F)cc3F)c12 |
| InChI | InChI=1S/C17H18F2N4S/c1-10-9-21-17(20)15-16(10)23(11(2)22-15)6-3-7-24-14-5-4-12(18)8-13(14)19/h4-5,8-9H,3,6-7H2,1-2H3,(H2,20,21) |
| InChIKey | ZYUJUXNKMAVLII-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|